C18H23FO2 — CID 62383929
4-[2-(cyclohexylmethoxymethyl)-5-fluorophenyl]but-3-yn-1-ol (PubChem CID 62383929) has the molecular formula C18H23FO2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 4-[2-(cyclohexylmethoxymethyl)-5-fluorophenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-(cyclohexylmethoxymethyl)-5-fluorophenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 62383929 |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-[2-(cyclohexylmethoxymethyl)-5-fluorophenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cc(F)ccc1COCC1CCCCC1 |
| InChI | InChI=1S/C18H23FO2/c19-18-10-9-17(16(12-18)8-4-5-11-20)14-21-13-15-6-2-1-3-7-15/h9-10,12,15,20H,1-3,5-7,11,13-14H2 |
| InChIKey | GPXGVDFZTWCHJV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|