C14H15FO2 — CID 62141594
3-[2-(cyclobutyloxymethyl)-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 62141594) has the molecular formula C14H15FO2 and a molecular weight of 234.27 g/mol. Its IUPAC name is 3-[2-(cyclobutyloxymethyl)-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-(cyclobutyloxymethyl)-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 62141594 |
| Molecular Formula | C14H15FO2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-[2-(cyclobutyloxymethyl)-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cc(F)ccc1COC1CCC1 |
| InChI | InChI=1S/C14H15FO2/c15-13-7-6-12(10-17-14-4-1-5-14)11(9-13)3-2-8-16/h6-7,9,14,16H,1,4-5,8,10H2 |
| InChIKey | WYOKJGSUHATPCM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|