C18H23FO2 — CID 64745980
3-[2-[(3,4-dimethylcyclohexyl)oxymethyl]-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 64745980) has the molecular formula C18H23FO2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-[2-[(3,4-dimethylcyclohexyl)oxymethyl]-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(3,4-dimethylcyclohexyl)oxymethyl]-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 64745980 |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-[2-[(3,4-dimethylcyclohexyl)oxymethyl]-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CC1CCC(OCc2ccc(F)cc2C#CCO)CC1C |
| InChI | InChI=1S/C18H23FO2/c1-13-5-8-18(10-14(13)2)21-12-16-6-7-17(19)11-15(16)4-3-9-20/h6-7,11,13-14,18,20H,5,8-10,12H2,1-2H3 |
| InChIKey | TXRZHELXJDQEED-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|