C16H11F3O2 — CID 63269968
3-[2-[(2,5-difluorophenoxy)methyl]-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 63269968) has the molecular formula C16H11F3O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3-[2-[(2,5-difluorophenoxy)methyl]-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(2,5-difluorophenoxy)methyl]-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 63269968 |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-[2-[(2,5-difluorophenoxy)methyl]-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cc(F)ccc1COc1cc(F)ccc1F |
| InChI | InChI=1S/C16H11F3O2/c17-13-4-3-12(11(8-13)2-1-7-20)10-21-16-9-14(18)5-6-15(16)19/h3-6,8-9,20H,7,10H2 |
| InChIKey | YRPSDRHQXBRMEF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|