C17H14ClFO2 — CID 106868906
3-[2-[(2-chloro-4-methylphenyl)methoxy]-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 106868906) has the molecular formula C17H14ClFO2 and a molecular weight of 304.75 g/mol. Its IUPAC name is 3-[2-[(2-chloro-4-methylphenyl)methoxy]-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(2-chloro-4-methylphenyl)methoxy]-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 106868906 |
| Molecular Formula | C17H14ClFO2 |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-[2-[(2-chloro-4-methylphenyl)methoxy]-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | Cc1ccc(COc2ccc(F)cc2C#CCO)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClFO2/c1-12-4-5-14(16(18)9-12)11-21-17-7-6-15(19)10-13(17)3-2-8-20/h4-7,9-10,20H,8,11H2,1H3 |
| InChIKey | BSKOFRGKRUPVFK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|