C17H15ClO2 — CID 60801804
3-[2-[(2-chlorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-ol (PubChem CID 60801804) has the molecular formula C17H15ClO2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 3-[2-[(2-chlorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(2-chlorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 60801804 |
| Molecular Formula | C17H15ClO2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-[2-[(2-chlorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-ol |
| SMILES | Cc1ccc(OCc2ccccc2Cl)c(C#CCO)c1 |
| InChI | InChI=1S/C17H15ClO2/c1-13-8-9-17(14(11-13)6-4-10-19)20-12-15-5-2-3-7-16(15)18/h2-3,5,7-9,11,19H,10,12H2,1H3 |
| InChIKey | ARGIVJBHTGZNFJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|