C18H17FO2 — CID 60800079
4-[2-[(2-fluorophenyl)methoxy]-5-methylphenyl]but-3-yn-1-ol (PubChem CID 60800079) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-[2-[(2-fluorophenyl)methoxy]-5-methylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-[(2-fluorophenyl)methoxy]-5-methylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 60800079 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-[2-[(2-fluorophenyl)methoxy]-5-methylphenyl]but-3-yn-1-ol |
| SMILES | Cc1ccc(OCc2ccccc2F)c(C#CCCO)c1 |
| InChI | InChI=1S/C18H17FO2/c1-14-9-10-18(15(12-14)6-4-5-11-20)21-13-16-7-2-3-8-17(16)19/h2-3,7-10,12,20H,5,11,13H2,1H3 |
| InChIKey | WJUZIKWZWAHCSH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|