C16H22O3 — CID 65180661
4-[2-(3-ethoxypropoxy)-5-methylphenyl]but-3-yn-1-ol (PubChem CID 65180661) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-[2-(3-ethoxypropoxy)-5-methylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-(3-ethoxypropoxy)-5-methylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 65180661 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4-[2-(3-ethoxypropoxy)-5-methylphenyl]but-3-yn-1-ol |
| SMILES | CCOCCCOc1ccc(C)cc1C#CCCO |
| InChI | InChI=1S/C16H22O3/c1-3-18-11-6-12-19-16-9-8-14(2)13-15(16)7-4-5-10-17/h8-9,13,17H,3,5-6,10-12H2,1-2H3 |
| InChIKey | KWKMEJGFOJROQS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|