C17H22O2 — CID 61342842
4-[2-(cyclopentylmethoxy)-5-methylphenyl]but-3-yn-1-ol (PubChem CID 61342842) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-[2-(cyclopentylmethoxy)-5-methylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-(cyclopentylmethoxy)-5-methylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 61342842 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 4-[2-(cyclopentylmethoxy)-5-methylphenyl]but-3-yn-1-ol |
| SMILES | Cc1ccc(OCC2CCCC2)c(C#CCCO)c1 |
| InChI | InChI=1S/C17H22O2/c1-14-9-10-17(16(12-14)8-4-5-11-18)19-13-15-6-2-3-7-15/h9-10,12,15,18H,2-3,5-7,11,13H2,1H3 |
| InChIKey | ITNDCXMBBVHULY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|