C16H18ClFO — CID 55197478
2-(4-chlorobut-1-ynyl)-1-(cyclopentylmethoxy)-4-fluorobenzene (PubChem CID 55197478) has the molecular formula C16H18ClFO and a molecular weight of 280.77 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-1-(cyclopentylmethoxy)-4-fluorobenzene.
| Compound Name | 2-(4-chlorobut-1-ynyl)-1-(cyclopentylmethoxy)-4-fluorobenzene |
|---|---|
| PubChem CID | 55197478 |
| Molecular Formula | C16H18ClFO |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-1-(cyclopentylmethoxy)-4-fluorobenzene |
| SMILES | Fc1ccc(OCC2CCCC2)c(C#CCCCl)c1 |
| InChI | InChI=1S/C16H18ClFO/c17-10-4-3-7-14-11-15(18)8-9-16(14)19-12-13-5-1-2-6-13/h8-9,11,13H,1-2,4-6,10,12H2 |
| InChIKey | CTOXDSXHZPFNIB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|