C15H18ClFO3S — CID 65095669
2-(4-chlorobut-1-ynyl)-1-(3-ethylsulfonylpropoxy)-4-fluorobenzene (PubChem CID 65095669) has the molecular formula C15H18ClFO3S and a molecular weight of 332.82 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-1-(3-ethylsulfonylpropoxy)-4-fluorobenzene.
| Compound Name | 2-(4-chlorobut-1-ynyl)-1-(3-ethylsulfonylpropoxy)-4-fluorobenzene |
|---|---|
| PubChem CID | 65095669 |
| Molecular Formula | C15H18ClFO3S |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-1-(3-ethylsulfonylpropoxy)-4-fluorobenzene |
| SMILES | CCS(=O)(=O)CCCOc1ccc(F)cc1C#CCCCl |
| InChI | InChI=1S/C15H18ClFO3S/c1-2-21(18,19)11-5-10-20-15-8-7-14(17)12-13(15)6-3-4-9-16/h7-8,12H,2,4-5,9-11H2,1H3 |
| InChIKey | YSOTWCKTTYPNFC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|