C14H17FO4S — CID 65095366
3-[2-(3-ethylsulfonylpropoxy)-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 65095366) has the molecular formula C14H17FO4S and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-[2-(3-ethylsulfonylpropoxy)-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-(3-ethylsulfonylpropoxy)-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 65095366 |
| Molecular Formula | C14H17FO4S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-[2-(3-ethylsulfonylpropoxy)-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CCS(=O)(=O)CCCOc1ccc(F)cc1C#CCO |
| InChI | InChI=1S/C14H17FO4S/c1-2-20(17,18)10-4-9-19-14-7-6-13(15)11-12(14)5-3-8-16/h6-7,11,16H,2,4,8-10H2,1H3 |
| InChIKey | DRKLIBGEKHFSIA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|