C14H18O4S — CID 54914350
3-[2-(2-ethylsulfonylethoxy)-5-methylphenyl]prop-2-yn-1-ol (PubChem CID 54914350) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-[2-(2-ethylsulfonylethoxy)-5-methylphenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-(2-ethylsulfonylethoxy)-5-methylphenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 54914350 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[2-(2-ethylsulfonylethoxy)-5-methylphenyl]prop-2-yn-1-ol |
| SMILES | CCS(=O)(=O)CCOc1ccc(C)cc1C#CCO |
| InChI | InChI=1S/C14H18O4S/c1-3-19(16,17)10-9-18-14-7-6-12(2)11-13(14)5-4-8-15/h6-7,11,15H,3,8-10H2,1-2H3 |
| InChIKey | BAKFZIWQGKIHHG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|