C15H19ClFNO — CID 54923375
2-[2-(3-chloroprop-1-ynyl)-4-fluorophenoxy]-N,N-diethylethanamine (PubChem CID 54923375) has the molecular formula C15H19ClFNO and a molecular weight of 283.77 g/mol. Its IUPAC name is 2-[2-(3-chloroprop-1-ynyl)-4-fluorophenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[2-(3-chloroprop-1-ynyl)-4-fluorophenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 54923375 |
| Molecular Formula | C15H19ClFNO |
| Molecular Weight | 283.77 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[2-(3-chloroprop-1-ynyl)-4-fluorophenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(F)cc1C#CCCl |
| InChI | InChI=1S/C15H19ClFNO/c1-3-18(4-2)10-11-19-15-8-7-14(17)12-13(15)6-5-9-16/h7-8,12H,3-4,9-11H2,1-2H3 |
| InChIKey | VBWRXOQFLCAXKX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|