C15H16ClF3O — CID 115517643
2-(4-chlorobut-1-ynyl)-4-methyl-1-(4,4,4-trifluorobutoxy)benzene (PubChem CID 115517643) has the molecular formula C15H16ClF3O and a molecular weight of 304.74 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-4-methyl-1-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 2-(4-chlorobut-1-ynyl)-4-methyl-1-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 115517643 |
| Molecular Formula | C15H16ClF3O |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-4-methyl-1-(4,4,4-trifluorobutoxy)benzene |
| SMILES | Cc1ccc(OCCCC(F)(F)F)c(C#CCCCl)c1 |
| InChI | InChI=1S/C15H16ClF3O/c1-12-6-7-14(13(11-12)5-2-3-9-16)20-10-4-8-15(17,18)19/h6-7,11H,3-4,8-10H2,1H3 |
| InChIKey | BWYUGMWJSOSJIQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|