C16H21ClO — CID 63418642
2-(3-chloroprop-1-ynyl)-1-(3,3-dimethylbutoxy)-4-methylbenzene (PubChem CID 63418642) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-(3-chloroprop-1-ynyl)-1-(3,3-dimethylbutoxy)-4-methylbenzene.
| Compound Name | 2-(3-chloroprop-1-ynyl)-1-(3,3-dimethylbutoxy)-4-methylbenzene |
|---|---|
| PubChem CID | 63418642 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-(3-chloroprop-1-ynyl)-1-(3,3-dimethylbutoxy)-4-methylbenzene |
| SMILES | Cc1ccc(OCCC(C)(C)C)c(C#CCCl)c1 |
| InChI | InChI=1S/C16H21ClO/c1-13-7-8-15(14(12-13)6-5-10-17)18-11-9-16(2,3)4/h7-8,12H,9-11H2,1-4H3 |
| InChIKey | GSDIPSUFDVLORI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|