C18H17ClO — CID 60801493
2-(3-chloroprop-1-ynyl)-4-methyl-1-(2-phenylethoxy)benzene (PubChem CID 60801493) has the molecular formula C18H17ClO and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-(3-chloroprop-1-ynyl)-4-methyl-1-(2-phenylethoxy)benzene.
| Compound Name | 2-(3-chloroprop-1-ynyl)-4-methyl-1-(2-phenylethoxy)benzene |
|---|---|
| PubChem CID | 60801493 |
| Molecular Formula | C18H17ClO |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(3-chloroprop-1-ynyl)-4-methyl-1-(2-phenylethoxy)benzene |
| SMILES | Cc1ccc(OCCc2ccccc2)c(C#CCCl)c1 |
| InChI | InChI=1S/C18H17ClO/c1-15-9-10-18(17(14-15)8-5-12-19)20-13-11-16-6-3-2-4-7-16/h2-4,6-7,9-10,14H,11-13H2,1H3 |
| InChIKey | RFCPFMNTLQIXHZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|