C17H16ClNO2 — CID 82899383
1-[2-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]ethyl]pyridin-2-one (PubChem CID 82899383) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is 1-[2-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 82899383 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-[2-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]ethyl]pyridin-2-one |
| SMILES | Cc1ccc(OCCn2ccccc2=O)c(C#CCCl)c1 |
| InChI | InChI=1S/C17H16ClNO2/c1-14-7-8-16(15(13-14)5-4-9-18)21-12-11-19-10-3-2-6-17(19)20/h2-3,6-8,10,13H,9,11-12H2,1H3 |
| InChIKey | ZUOFKWXCPWZKMH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|