C17H17NO3 — CID 82899377
1-[2-[2-(4-hydroxybut-1-ynyl)phenoxy]ethyl]pyridin-2-one (PubChem CID 82899377) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[2-[2-(4-hydroxybut-1-ynyl)phenoxy]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[2-(4-hydroxybut-1-ynyl)phenoxy]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 82899377 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[2-[2-(4-hydroxybut-1-ynyl)phenoxy]ethyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCOc1ccccc1C#CCCO |
| InChI | InChI=1S/C17H17NO3/c19-13-6-4-8-15-7-1-2-9-16(15)21-14-12-18-11-5-3-10-17(18)20/h1-3,5,7,9-11,19H,6,12-14H2 |
| InChIKey | OHNFTSUUJHXQCJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|