C12H13Cl — CID 60799689
1-(4-chlorobut-1-ynyl)-2,4-dimethylbenzene (PubChem CID 60799689) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-(4-chlorobut-1-ynyl)-2,4-dimethylbenzene.
| Compound Name | 1-(4-chlorobut-1-ynyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 60799689 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-(4-chlorobut-1-ynyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C#CCCCl)c(C)c1 |
| InChI | InChI=1S/C12H13Cl/c1-10-6-7-12(11(2)9-10)5-3-4-8-13/h6-7,9H,4,8H2,1-2H3 |
| InChIKey | PRSDOCUJGQXFMP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|