C10H9Tl — CID 142762596
2-(2,4-dimethylphenyl)ethynylthallium (PubChem CID 142762596) has the molecular formula C10H9Tl and a molecular weight of 333.57 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)ethynylthallium.
| Compound Name | 2-(2,4-dimethylphenyl)ethynylthallium |
|---|---|
| PubChem CID | 142762596 |
| Molecular Formula | C10H9Tl |
| Molecular Weight | 333.57 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-(2,4-dimethylphenyl)ethynylthallium |
| SMILES | Cc1ccc(C#C[Tl])c(C)c1 |
| InChI | InChI=1S/C10H9.Tl/c1-4-10-6-5-8(2)7-9(10)3;/h5-7H,2-3H3; |
| InChIKey | JTFPAFCSULTOEV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|