C35H34 — CID 158296087
2,4-dimethyl-1-[2-(4-methylphenyl)ethynyl]benzene;1-[2-(4-ethylphenyl)ethynyl]-2,4-dimethylbenzene (PubChem CID 158296087) has the molecular formula C35H34 and a molecular weight of 454.66 g/mol. Its IUPAC name is 2,4-dimethyl-1-[2-(4-methylphenyl)ethynyl]benzene;1-[2-(4-ethylphenyl)ethynyl]-2,4-dimethylbenzene.
| Compound Name | 2,4-dimethyl-1-[2-(4-methylphenyl)ethynyl]benzene;1-[2-(4-ethylphenyl)ethynyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 158296087 |
| Molecular Formula | C35H34 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 2,4-dimethyl-1-[2-(4-methylphenyl)ethynyl]benzene;1-[2-(4-ethylphenyl)ethynyl]-2,4-dimethylbenzene |
| SMILES | CCc1ccc(C#Cc2ccc(C)cc2C)cc1.Cc1ccc(C#Cc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C18H18.C17H16/c1-4-16-6-8-17(9-7-16)10-12-18-11-5-14(2)13-15(18)3;1-13-4-7-16(8-5-13)9-11-17-10-6-14(2)12-15(17)3/h5-9,11,13H,4H2,1-3H3;4-8,10,12H,1-3H3 |
| InChIKey | GLXQKTVSIJQCKX-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|