C14H16N4O2 — CID 107051602
4-[5-methyl-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]but-3-yn-1-ol (PubChem CID 107051602) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-[5-methyl-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[5-methyl-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 107051602 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-[5-methyl-2-[(2-methyltetrazol-5-yl)methoxy]phenyl]but-3-yn-1-ol |
| SMILES | Cc1ccc(OCc2nnn(C)n2)c(C#CCCO)c1 |
| InChI | InChI=1S/C14H16N4O2/c1-11-6-7-13(12(9-11)5-3-4-8-19)20-10-14-15-17-18(2)16-14/h6-7,9,19H,4,8,10H2,1-2H3 |
| InChIKey | DLDYOTLNDJNBFG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|