C17H14F2O2 — CID 63037486
4-[2-[(2,3-difluorophenoxy)methyl]phenyl]but-3-yn-1-ol (PubChem CID 63037486) has the molecular formula C17H14F2O2 and a molecular weight of 288.29 g/mol. Its IUPAC name is 4-[2-[(2,3-difluorophenoxy)methyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-[(2,3-difluorophenoxy)methyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 63037486 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-[2-[(2,3-difluorophenoxy)methyl]phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccccc1COc1cccc(F)c1F |
| InChI | InChI=1S/C17H14F2O2/c18-15-9-5-10-16(17(15)19)21-12-14-8-2-1-6-13(14)7-3-4-11-20/h1-2,5-6,8-10,20H,4,11-12H2 |
| InChIKey | QLYZMXMUQYYTEF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|