C9H10F2O2 — CID 63037951
3-(2,3-difluorophenoxy)propan-1-ol (PubChem CID 63037951) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 3-(2,3-difluorophenoxy)propan-1-ol.
| Compound Name | 3-(2,3-difluorophenoxy)propan-1-ol |
|---|---|
| PubChem CID | 63037951 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-(2,3-difluorophenoxy)propan-1-ol |
| SMILES | OCCCOc1cccc(F)c1F |
| InChI | InChI=1S/C9H10F2O2/c10-7-3-1-4-8(9(7)11)13-6-2-5-12/h1,3-4,12H,2,5-6H2 |
| InChIKey | DNCHNPSUDGFCBR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|