C10H13F2O2P — CID 59036591
4-(2,3-difluorophenoxy)butoxyphosphane (PubChem CID 59036591) has the molecular formula C10H13F2O2P and a molecular weight of 234.18 g/mol. Its IUPAC name is 4-(2,3-difluorophenoxy)butoxyphosphane.
| Compound Name | 4-(2,3-difluorophenoxy)butoxyphosphane |
|---|---|
| PubChem CID | 59036591 |
| Molecular Formula | C10H13F2O2P |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-(2,3-difluorophenoxy)butoxyphosphane |
| SMILES | Fc1cccc(OCCCCOP)c1F |
| InChI | InChI=1S/C10H13F2O2P/c11-8-4-3-5-9(10(8)12)13-6-1-2-7-14-15/h3-5H,1-2,6-7,15H2 |
| InChIKey | MZMYKAROQGBGNP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|