C11H14F2O2 — CID 90941481
1,2-difluoro-3-(3-methoxybutoxy)benzene (PubChem CID 90941481) has the molecular formula C11H14F2O2 and a molecular weight of 216.23 g/mol. Its IUPAC name is 1,2-difluoro-3-(3-methoxybutoxy)benzene.
| Compound Name | 1,2-difluoro-3-(3-methoxybutoxy)benzene |
|---|---|
| PubChem CID | 90941481 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1,2-difluoro-3-(3-methoxybutoxy)benzene |
| SMILES | COC(C)CCOc1cccc(F)c1F |
| InChI | InChI=1S/C11H14F2O2/c1-8(14-2)6-7-15-10-5-3-4-9(12)11(10)13/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | DBTHRCQANDCQOB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |