C13H14F2O2 — CID 82006810
4-[2-(2,2-difluoroethoxymethyl)phenyl]but-3-yn-1-ol (PubChem CID 82006810) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-[2-(2,2-difluoroethoxymethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-(2,2-difluoroethoxymethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 82006810 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[2-(2,2-difluoroethoxymethyl)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccccc1COCC(F)F |
| InChI | InChI=1S/C13H14F2O2/c14-13(15)10-17-9-12-7-2-1-5-11(12)6-3-4-8-16/h1-2,5,7,13,16H,4,8-10H2 |
| InChIKey | HREHLTGWPSORPR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|