C12H11F3O2 — CID 82007412
3-[2-(2,2-difluoroethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 82007412) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-(2,2-difluoroethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 82007412 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cc(F)ccc1COCC(F)F |
| InChI | InChI=1S/C12H11F3O2/c13-11-4-3-10(7-17-8-12(14)15)9(6-11)2-1-5-16/h3-4,6,12,16H,5,7-8H2 |
| InChIKey | WWBHQUTYRHUURJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|