About 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol
4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol (PubChem CID 82006210) has the molecular formula C13H13F3O2
and a molecular weight of 258.24 g/mol. Its IUPAC name is 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol |
| PubChem CID | 82006210 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cc(COCC(F)F)ccc1F |
| InChI | InChI=1S/C13H13F3O2/c14-12-5-4-10(8-18-9-13(15)16)7-11(12)3-1-2-6-17/h4-5,7,13,17H,2,6,8-9H2 |
| InChIKey | CZPQRSOWMHXDQF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol?
The IUPAC name of 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol (CID 82006210) is 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol.
What is the SMILES notation for 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol?
The canonical SMILES for 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol is OCCC#Cc1cc(COCC(F)F)ccc1F.
What is the InChIKey of 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol?
The InChIKey is CZPQRSOWMHXDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3O2/c14-12-5-4-10(8-18-9-13(15)16)7-11(12)3-1-2-6-17/h4-5,7,13,17H,2,6,8-9H2.
What are the key properties of 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol?
4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol has a molecular weight of 258.24 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,2-difluoroethoxymethyl)-2-fluorophenyl]but-3-yn-1-ol is sourced from PubChem (CID 82006210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).