C12H11F3O2 — CID 65203248
4-[4-(2,2-difluoroethoxy)-2-fluorophenyl]but-3-yn-1-ol (PubChem CID 65203248) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 4-[4-(2,2-difluoroethoxy)-2-fluorophenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-(2,2-difluoroethoxy)-2-fluorophenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 65203248 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-[4-(2,2-difluoroethoxy)-2-fluorophenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccc(OCC(F)F)cc1F |
| InChI | InChI=1S/C12H11F3O2/c13-11-7-10(17-8-12(14)15)5-4-9(11)3-1-2-6-16/h4-5,7,12,16H,2,6,8H2 |
| InChIKey | ITNBGEVLRFUMBA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|