C15H17FO3 — CID 106930254
4-[4-(cyclopropylmethoxymethoxy)-2-fluorophenyl]but-3-yn-1-ol (PubChem CID 106930254) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-[4-(cyclopropylmethoxymethoxy)-2-fluorophenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-(cyclopropylmethoxymethoxy)-2-fluorophenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 106930254 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-[4-(cyclopropylmethoxymethoxy)-2-fluorophenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccc(OCOCC2CC2)cc1F |
| InChI | InChI=1S/C15H17FO3/c16-15-9-14(19-11-18-10-12-4-5-12)7-6-13(15)3-1-2-8-17/h6-7,9,12,17H,2,4-5,8,10-11H2 |
| InChIKey | PWIBSSMNSNSCNS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|