C14H15FO3 — CID 65202481
3-[2-fluoro-4-(oxolan-2-ylmethoxy)phenyl]prop-2-yn-1-ol (PubChem CID 65202481) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-[2-fluoro-4-(oxolan-2-ylmethoxy)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-fluoro-4-(oxolan-2-ylmethoxy)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 65202481 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-[2-fluoro-4-(oxolan-2-ylmethoxy)phenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc(OCC2CCCO2)cc1F |
| InChI | InChI=1S/C14H15FO3/c15-14-9-12(6-5-11(14)3-1-7-16)18-10-13-4-2-8-17-13/h5-6,9,13,16H,2,4,7-8,10H2 |
| InChIKey | IBDLYGLSXWVRMF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|