C12H16O3 — CID 43199011
[3-(oxolan-2-ylmethoxy)phenyl]methanol (PubChem CID 43199011) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is [3-(oxolan-2-ylmethoxy)phenyl]methanol.
| Compound Name | [3-(oxolan-2-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 43199011 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [3-(oxolan-2-ylmethoxy)phenyl]methanol |
| SMILES | OCc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C12H16O3/c13-8-10-3-1-4-11(7-10)15-9-12-5-2-6-14-12/h1,3-4,7,12-13H,2,5-6,8-9H2 |
| InChIKey | WPOCXMLIIXJGNH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |