C23H27NO3 — CID 26320335
N-cyclopropyl-4-methyl-N-[[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]benzamide (PubChem CID 26320335) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-N-[[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-N-[[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 26320335 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-cyclopropyl-4-methyl-N-[[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(Cc2cccc(OC[C@@H]3CCCO3)c2)C2CC2)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-17-7-9-19(10-8-17)23(25)24(20-11-12-20)15-18-4-2-5-21(14-18)27-16-22-6-3-13-26-22/h2,4-5,7-10,14,20,22H,3,6,11-13,15-16H2,1H3/t22-/m0/s1 |
| InChIKey | QYVGUYNOYRHYMN-QFIPXVFZSA-N |
| XLogP | 4.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |