C22H27NO4 — CID 112817367
N-cyclopentyl-N-(furan-2-ylmethyl)-3-(oxolan-2-ylmethoxy)benzamide (PubChem CID 112817367) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-cyclopentyl-N-(furan-2-ylmethyl)-3-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-cyclopentyl-N-(furan-2-ylmethyl)-3-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 112817367 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-cyclopentyl-N-(furan-2-ylmethyl)-3-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(c1cccc(OCC2CCCO2)c1)N(Cc1ccco1)C1CCCC1 |
| InChI | InChI=1S/C22H27NO4/c24-22(23(18-7-1-2-8-18)15-20-10-4-12-25-20)17-6-3-9-19(14-17)27-16-21-11-5-13-26-21/h3-4,6,9-10,12,14,18,21H,1-2,5,7-8,11,13,15-16H2 |
| InChIKey | JRGZIZDCVZJVGH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |