C30H34N2O2 — CID 45175801
N-cyclopropyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]-4-phenylbenzamide (PubChem CID 45175801) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-cyclopropyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]-4-phenylbenzamide.
| Compound Name | N-cyclopropyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 45175801 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-cyclopropyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]-4-phenylbenzamide |
| SMILES | CN1CCCC(COc2cccc(CN(C(=O)c3ccc(-c4ccccc4)cc3)C3CC3)c2)C1 |
| InChI | InChI=1S/C30H34N2O2/c1-31-18-6-8-24(20-31)22-34-29-11-5-7-23(19-29)21-32(28-16-17-28)30(33)27-14-12-26(13-15-27)25-9-3-2-4-10-25/h2-5,7,9-15,19,24,28H,6,8,16-18,20-22H2,1H3 |
| InChIKey | SDBLEKSXUJZUKR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |