C13H18INO — CID 165429240
(3S)-3-[(3-iodophenoxy)methyl]-1-methylpiperidine (PubChem CID 165429240) has the molecular formula C13H18INO and a molecular weight of 331.20 g/mol. Its IUPAC name is (3S)-3-[(3-iodophenoxy)methyl]-1-methylpiperidine.
| Compound Name | (3S)-3-[(3-iodophenoxy)methyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 165429240 |
| Molecular Formula | C13H18INO |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (3S)-3-[(3-iodophenoxy)methyl]-1-methylpiperidine |
| SMILES | CN1CCC[C@H](COc2cccc(I)c2)C1 |
| InChI | InChI=1S/C13H18INO/c1-15-7-3-4-11(9-15)10-16-13-6-2-5-12(14)8-13/h2,5-6,8,11H,3-4,7,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | DZMGDPRLKZTXIC-NSHDSACASA-N |
| XLogP | 3.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|