C20H34ClNO — CID 67869623
1-pentyl-3-[(3-propan-2-ylphenoxy)methyl]piperidine;hydrochloride (PubChem CID 67869623) has the molecular formula C20H34ClNO and a molecular weight of 339.95 g/mol. Its IUPAC name is 1-pentyl-3-[(3-propan-2-ylphenoxy)methyl]piperidine;hydrochloride.
| Compound Name | 1-pentyl-3-[(3-propan-2-ylphenoxy)methyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 67869623 |
| Molecular Formula | C20H34ClNO |
| Molecular Weight | 339.95 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 1-pentyl-3-[(3-propan-2-ylphenoxy)methyl]piperidine;hydrochloride |
| SMILES | CCCCCN1CCCC(COc2cccc(C(C)C)c2)C1.Cl |
| InChI | InChI=1S/C20H33NO.ClH/c1-4-5-6-12-21-13-8-9-18(15-21)16-22-20-11-7-10-19(14-20)17(2)3;/h7,10-11,14,17-18H,4-6,8-9,12-13,15-16H2,1-3H3;1H |
| InChIKey | XVZLOBFFZQALGK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.95 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|