C12H15IO — CID 124747316
1-iodo-3-[[(1R,2S)-2-methylcyclobutyl]methoxy]benzene (PubChem CID 124747316) has the molecular formula C12H15IO and a molecular weight of 302.15 g/mol. Its IUPAC name is 1-iodo-3-[[(1R,2S)-2-methylcyclobutyl]methoxy]benzene.
| Compound Name | 1-iodo-3-[[(1R,2S)-2-methylcyclobutyl]methoxy]benzene |
|---|---|
| PubChem CID | 124747316 |
| Molecular Formula | C12H15IO |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1-iodo-3-[[(1R,2S)-2-methylcyclobutyl]methoxy]benzene |
| SMILES | C[C@H]1CC[C@H]1COc1cccc(I)c1 |
| InChI | InChI=1S/C12H15IO/c1-9-5-6-10(9)8-14-12-4-2-3-11(13)7-12/h2-4,7,9-10H,5-6,8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | RFVHRHWKAUGMAG-UWVGGRQHSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|