About 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline
3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline (PubChem CID 97034249) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline.
Molecular Properties
| Compound Name | 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline |
| PubChem CID | 97034249 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline |
| SMILES | C[C@H]1C[C@@H]1COc1cccc(N)c1 |
| InChI | InChI=1S/C11H15NO/c1-8-5-9(8)7-13-11-4-2-3-10(12)6-11/h2-4,6,8-9H,5,7,12H2,1H3/t8-,9+/m0/s1 |
| InChIKey | FGKSZIXQCKFVBB-DTWKUNHWSA-N |
| XLogP | 2.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline?
The IUPAC name of 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline (CID 97034249) is 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline.
What is the SMILES notation for 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline?
The canonical SMILES for 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline is C[C@H]1C[C@@H]1COc1cccc(N)c1.
What is the InChIKey of 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline?
The InChIKey is FGKSZIXQCKFVBB-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H15NO/c1-8-5-9(8)7-13-11-4-2-3-10(12)6-11/h2-4,6,8-9H,5,7,12H2,1H3/t8-,9+/m0/s1.
What are the key properties of 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline?
3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline has a molecular weight of 177.25 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,2S)-2-methylcyclopropyl]methoxy]aniline is sourced from PubChem (CID 97034249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).