C14H18ClF3INO — CID 165429386
4-[(3-iodophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine;hydrochloride (PubChem CID 165429386) has the molecular formula C14H18ClF3INO and a molecular weight of 435.66 g/mol. Its IUPAC name is 4-[(3-iodophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine;hydrochloride.
| Compound Name | 4-[(3-iodophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 165429386 |
| Molecular Formula | C14H18ClF3INO |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 4-[(3-iodophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine;hydrochloride |
| SMILES | Cl.FC(F)(F)CN1CCC(COc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C14H17F3INO.ClH/c15-14(16,17)10-19-6-4-11(5-7-19)9-20-13-3-1-2-12(18)8-13;/h1-3,8,11H,4-7,9-10H2;1H |
| InChIKey | BIFDAQLZYXWPKW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|