C14H17BrF3NO — CID 165429268
3-[(3-bromophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine (PubChem CID 165429268) has the molecular formula C14H17BrF3NO and a molecular weight of 352.19 g/mol. Its IUPAC name is 3-[(3-bromophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine.
| Compound Name | 3-[(3-bromophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine |
|---|---|
| PubChem CID | 165429268 |
| Molecular Formula | C14H17BrF3NO |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 3-[(3-bromophenoxy)methyl]-1-(2,2,2-trifluoroethyl)piperidine |
| SMILES | FC(F)(F)CN1CCCC(COc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C14H17BrF3NO/c15-12-4-1-5-13(7-12)20-9-11-3-2-6-19(8-11)10-14(16,17)18/h1,4-5,7,11H,2-3,6,8-10H2 |
| InChIKey | RKPXHTSBQFXVEY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |