C15H17BrF5NO — CID 118110041
4-[(4-bromophenoxy)methyl]-1-(2,2,3,3,3-pentafluoropropyl)piperidine (PubChem CID 118110041) has the molecular formula C15H17BrF5NO and a molecular weight of 402.20 g/mol. Its IUPAC name is 4-[(4-bromophenoxy)methyl]-1-(2,2,3,3,3-pentafluoropropyl)piperidine.
| Compound Name | 4-[(4-bromophenoxy)methyl]-1-(2,2,3,3,3-pentafluoropropyl)piperidine |
|---|---|
| PubChem CID | 118110041 |
| Molecular Formula | C15H17BrF5NO |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-[(4-bromophenoxy)methyl]-1-(2,2,3,3,3-pentafluoropropyl)piperidine |
| SMILES | FC(F)(F)C(F)(F)CN1CCC(COc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H17BrF5NO/c16-12-1-3-13(4-2-12)23-9-11-5-7-22(8-6-11)10-14(17,18)15(19,20)21/h1-4,11H,5-10H2 |
| InChIKey | KLCRIFSMGDACOH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|