C22H21F6NO3 — CID 118118942
2-fluoro-4-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoic acid (PubChem CID 118118942) has the molecular formula C22H21F6NO3 and a molecular weight of 461.40 g/mol. Its IUPAC name is 2-fluoro-4-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoic acid.
| Compound Name | 2-fluoro-4-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 118118942 |
| Molecular Formula | C22H21F6NO3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-fluoro-4-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(OCC3CCN(CC(F)(F)C(F)(F)F)CC3)cc2)cc1F |
| InChI | InChI=1S/C22H21F6NO3/c23-19-11-16(3-6-18(19)20(30)31)15-1-4-17(5-2-15)32-12-14-7-9-29(10-8-14)13-21(24,25)22(26,27)28/h1-6,11,14H,7-10,12-13H2,(H,30,31) |
| InChIKey | BDQHVJXOFGBCOY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|