C25H32N2O2 — CID 45201934
N-cyclopropyl-4-methyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]benzamide (PubChem CID 45201934) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 45201934 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-cyclopropyl-4-methyl-N-[[3-[(1-methylpiperidin-3-yl)methoxy]phenyl]methyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(Cc2cccc(OCC3CCCN(C)C3)c2)C2CC2)cc1 |
| InChI | InChI=1S/C25H32N2O2/c1-19-8-10-22(11-9-19)25(28)27(23-12-13-23)17-20-5-3-7-24(15-20)29-18-21-6-4-14-26(2)16-21/h3,5,7-11,15,21,23H,4,6,12-14,16-18H2,1-2H3 |
| InChIKey | SOKYZAWZKDXTMA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |