C21H23NO4 — CID 55873499
methyl 2-[3-[cyclopropyl-[(4-methylphenyl)methyl]carbamoyl]phenoxy]acetate (PubChem CID 55873499) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 2-[3-[cyclopropyl-[(4-methylphenyl)methyl]carbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[cyclopropyl-[(4-methylphenyl)methyl]carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55873499 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl 2-[3-[cyclopropyl-[(4-methylphenyl)methyl]carbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(C(=O)N(Cc2ccc(C)cc2)C2CC2)c1 |
| InChI | InChI=1S/C21H23NO4/c1-15-6-8-16(9-7-15)13-22(18-10-11-18)21(24)17-4-3-5-19(12-17)26-14-20(23)25-2/h3-9,12,18H,10-11,13-14H2,1-2H3 |
| InChIKey | DMBBIUOFODNOCA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |