C28H28FNO3 — CID 42377641
N-cyclopropyl-3-(3-fluorophenyl)-N-[[3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]benzamide (PubChem CID 42377641) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is N-cyclopropyl-3-(3-fluorophenyl)-N-[[3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]benzamide.
| Compound Name | N-cyclopropyl-3-(3-fluorophenyl)-N-[[3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 42377641 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-cyclopropyl-3-(3-fluorophenyl)-N-[[3-[[(3S)-oxolan-3-yl]methoxy]phenyl]methyl]benzamide |
| SMILES | O=C(c1cccc(-c2cccc(F)c2)c1)N(Cc1cccc(OC[C@H]2CCOC2)c1)C1CC1 |
| InChI | InChI=1S/C28H28FNO3/c29-25-8-3-6-23(16-25)22-5-2-7-24(15-22)28(31)30(26-10-11-26)17-20-4-1-9-27(14-20)33-19-21-12-13-32-18-21/h1-9,14-16,21,26H,10-13,17-19H2/t21-/m0/s1 |
| InChIKey | NBEZHPFIUUDDKR-NRFANRHFSA-N |
| XLogP | 5.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |