C23H24F3NO3 — CID 45184209
N-cyclopropyl-N-[[3-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(trifluoromethyl)benzamide (PubChem CID 45184209) has the molecular formula C23H24F3NO3 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-cyclopropyl-N-[[3-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-cyclopropyl-N-[[3-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 45184209 |
| Molecular Formula | C23H24F3NO3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-cyclopropyl-N-[[3-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(c1ccccc1C(F)(F)F)N(Cc1cccc(OCC2CCCO2)c1)C1CC1 |
| InChI | InChI=1S/C23H24F3NO3/c24-23(25,26)21-9-2-1-8-20(21)22(28)27(17-10-11-17)14-16-5-3-6-18(13-16)30-15-19-7-4-12-29-19/h1-3,5-6,8-9,13,17,19H,4,7,10-12,14-15H2 |
| InChIKey | IVMRWXIDRKVQQZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |