C23H33NO3 — CID 26336282
2-cyclopentyl-N-cyclopropyl-N-[[3-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]acetamide (PubChem CID 26336282) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 2-cyclopentyl-N-cyclopropyl-N-[[3-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]acetamide.
| Compound Name | 2-cyclopentyl-N-cyclopropyl-N-[[3-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 26336282 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 2-cyclopentyl-N-cyclopropyl-N-[[3-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]acetamide |
| SMILES | O=C(CC1CCCC1)N(Cc1cccc(OC[C@@H]2CCCCO2)c1)C1CC1 |
| InChI | InChI=1S/C23H33NO3/c25-23(15-18-6-1-2-7-18)24(20-11-12-20)16-19-8-5-10-21(14-19)27-17-22-9-3-4-13-26-22/h5,8,10,14,18,20,22H,1-4,6-7,9,11-13,15-17H2/t22-/m0/s1 |
| InChIKey | ILBJWDAJJHJRES-QFIPXVFZSA-N |
| XLogP | 4.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |